C18H12F3N5 — CID 112905475
3-[[4-[2-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 112905475) has the molecular formula C18H12F3N5 and a molecular weight of 355.32 g/mol. Its IUPAC name is 3-[[4-[2-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 3-[[4-[2-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112905475 |
| Molecular Formula | C18H12F3N5 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 3-[[4-[2-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1cccc(Nc2nccc(Nc3ccccc3C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C18H12F3N5/c19-18(20,21)14-6-1-2-7-15(14)25-16-8-9-23-17(26-16)24-13-5-3-4-12(10-13)11-22/h1-10H,(H2,23,24,25,26) |
| InChIKey | PGLHHCFYBWWDGJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |