C16H19N7O2 — CID 133406792
2-N-(2-tert-butyl-1-methylbenzimidazol-5-yl)-5-nitropyrimidine-2,4-diamine (PubChem CID 133406792) has the molecular formula C16H19N7O2 and a molecular weight of 341.38 g/mol. Its IUPAC name is 2-N-(2-tert-butyl-1-methylbenzimidazol-5-yl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-tert-butyl-1-methylbenzimidazol-5-yl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133406792 |
| Molecular Formula | C16H19N7O2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-N-(2-tert-butyl-1-methylbenzimidazol-5-yl)-5-nitropyrimidine-2,4-diamine |
| SMILES | Cn1c(C(C)(C)C)nc2cc(Nc3ncc([N+](=O)[O-])c(N)n3)ccc21 |
| InChI | InChI=1S/C16H19N7O2/c1-16(2,3)14-20-10-7-9(5-6-11(10)22(14)4)19-15-18-8-12(23(24)25)13(17)21-15/h5-8H,1-4H3,(H3,17,18,19,21) |
| InChIKey | QQMBTHVEAVUACU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|