C16H17N7O3 — CID 133324945
5-[(4-amino-5-nitropyrimidin-2-yl)amino]-2-(4-hydroxypiperidin-1-yl)benzonitrile (PubChem CID 133324945) has the molecular formula C16H17N7O3 and a molecular weight of 355.36 g/mol. Its IUPAC name is 5-[(4-amino-5-nitropyrimidin-2-yl)amino]-2-(4-hydroxypiperidin-1-yl)benzonitrile.
| Compound Name | 5-[(4-amino-5-nitropyrimidin-2-yl)amino]-2-(4-hydroxypiperidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 133324945 |
| Molecular Formula | C16H17N7O3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 5-[(4-amino-5-nitropyrimidin-2-yl)amino]-2-(4-hydroxypiperidin-1-yl)benzonitrile |
| SMILES | N#Cc1cc(Nc2ncc([N+](=O)[O-])c(N)n2)ccc1N1CCC(O)CC1 |
| InChI | InChI=1S/C16H17N7O3/c17-8-10-7-11(1-2-13(10)22-5-3-12(24)4-6-22)20-16-19-9-14(23(25)26)15(18)21-16/h1-2,7,9,12,24H,3-6H2,(H3,18,19,20,21) |
| InChIKey | CMCTZBHXMWJJFH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 154.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|