C18H26N4O — CID 111755812
2-(4-hydroxypiperidin-1-yl)-5-[(1-methylpiperidin-4-yl)amino]benzonitrile (PubChem CID 111755812) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-(4-hydroxypiperidin-1-yl)-5-[(1-methylpiperidin-4-yl)amino]benzonitrile.
| Compound Name | 2-(4-hydroxypiperidin-1-yl)-5-[(1-methylpiperidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 111755812 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 2-(4-hydroxypiperidin-1-yl)-5-[(1-methylpiperidin-4-yl)amino]benzonitrile |
| SMILES | CN1CCC(Nc2ccc(N3CCC(O)CC3)c(C#N)c2)CC1 |
| InChI | InChI=1S/C18H26N4O/c1-21-8-4-15(5-9-21)20-16-2-3-18(14(12-16)13-19)22-10-6-17(23)7-11-22/h2-3,12,15,17,20,23H,4-11H2,1H3 |
| InChIKey | PLEVHXLAGWUMGP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|