C16H18F3N3O2 — CID 111485552
N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]-4,4,4-trifluorobutanamide (PubChem CID 111485552) has the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 111485552 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]-4,4,4-trifluorobutanamide |
| SMILES | N#Cc1cc(NC(=O)CCC(F)(F)F)ccc1N1CCC(O)CC1 |
| InChI | InChI=1S/C16H18F3N3O2/c17-16(18,19)6-3-15(24)21-12-1-2-14(11(9-12)10-20)22-7-4-13(23)5-8-22/h1-2,9,13,23H,3-8H2,(H,21,24) |
| InChIKey | XEISGUHHBNMKGU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|