C19H23N3O2 — CID 95986876
N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]-2-[(1R)-cyclopent-2-en-1-yl]acetamide (PubChem CID 95986876) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]-2-[(1R)-cyclopent-2-en-1-yl]acetamide.
| Compound Name | N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]-2-[(1R)-cyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 95986876 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]-2-[(1R)-cyclopent-2-en-1-yl]acetamide |
| SMILES | N#Cc1cc(NC(=O)C[C@@H]2C=CCC2)ccc1N1CCC(O)CC1 |
| InChI | InChI=1S/C19H23N3O2/c20-13-15-12-16(21-19(24)11-14-3-1-2-4-14)5-6-18(15)22-9-7-17(23)8-10-22/h1,3,5-6,12,14,17,23H,2,4,7-11H2,(H,21,24)/t14-/m1/s1 |
| InChIKey | DTMPQNREFWAMHD-CQSZACIVSA-N |
| XLogP | 2.81 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|