C20H28FN3O — CID 95276445
2-[(1R)-cyclopent-2-en-1-yl]-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-fluorophenyl]acetamide (PubChem CID 95276445) has the molecular formula C20H28FN3O and a molecular weight of 345.46 g/mol. Its IUPAC name is 2-[(1R)-cyclopent-2-en-1-yl]-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-fluorophenyl]acetamide.
| Compound Name | 2-[(1R)-cyclopent-2-en-1-yl]-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 95276445 |
| Molecular Formula | C20H28FN3O |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 2-[(1R)-cyclopent-2-en-1-yl]-N-[4-[4-(dimethylamino)piperidin-1-yl]-3-fluorophenyl]acetamide |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)C[C@@H]3C=CCC3)cc2F)CC1 |
| InChI | InChI=1S/C20H28FN3O/c1-23(2)17-9-11-24(12-10-17)19-8-7-16(14-18(19)21)22-20(25)13-15-5-3-4-6-15/h3,5,7-8,14-15,17H,4,6,9-13H2,1-2H3,(H,22,25)/t15-/m1/s1 |
| InChIKey | IMKUAUICIJOAFV-OAHLLOKOSA-N |
| XLogP | 3.65 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|