C17H17N3O3 — CID 111485570
N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]furan-2-carboxamide (PubChem CID 111485570) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111485570 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]furan-2-carboxamide |
| SMILES | N#Cc1cc(NC(=O)c2ccco2)ccc1N1CCC(O)CC1 |
| InChI | InChI=1S/C17H17N3O3/c18-11-12-10-13(19-17(22)16-2-1-9-23-16)3-4-15(12)20-7-5-14(21)6-8-20/h1-4,9-10,14,21H,5-8H2,(H,19,22) |
| InChIKey | DPRRUPLKIUQKBN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|