C20H21N5OS — CID 133403463
5-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-2-(4-hydroxypiperidin-1-yl)benzonitrile (PubChem CID 133403463) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 5-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-2-(4-hydroxypiperidin-1-yl)benzonitrile.
| Compound Name | 5-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-2-(4-hydroxypiperidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 133403463 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 5-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-2-(4-hydroxypiperidin-1-yl)benzonitrile |
| SMILES | CCc1nc(Nc2ccc(N3CCC(O)CC3)c(C#N)c2)c2ccsc2n1 |
| InChI | InChI=1S/C20H21N5OS/c1-2-18-23-19(16-7-10-27-20(16)24-18)22-14-3-4-17(13(11-14)12-21)25-8-5-15(26)6-9-25/h3-4,7,10-11,15,26H,2,5-6,8-9H2,1H3,(H,22,23,24) |
| InChIKey | QKZXXHPKEYBAJG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|