C24H21N5OS — CID 133324876
2-(4-hydroxypiperidin-1-yl)-5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzonitrile (PubChem CID 133324876) has the molecular formula C24H21N5OS and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-(4-hydroxypiperidin-1-yl)-5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzonitrile.
| Compound Name | 2-(4-hydroxypiperidin-1-yl)-5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 133324876 |
| Molecular Formula | C24H21N5OS |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 2-(4-hydroxypiperidin-1-yl)-5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzonitrile |
| SMILES | N#Cc1cc(Nc2ncnc3sc(-c4ccccc4)cc23)ccc1N1CCC(O)CC1 |
| InChI | InChI=1S/C24H21N5OS/c25-14-17-12-18(6-7-21(17)29-10-8-19(30)9-11-29)28-23-20-13-22(16-4-2-1-3-5-16)31-24(20)27-15-26-23/h1-7,12-13,15,19,30H,8-11H2,(H,26,27,28) |
| InChIKey | ODEUSAGYNLSPFQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|