C19H14N6O3 — CID 133384840
5-nitro-2-[(1-phenylbenzimidazol-5-yl)amino]pyridine-3-carboxamide (PubChem CID 133384840) has the molecular formula C19H14N6O3 and a molecular weight of 374.36 g/mol. Its IUPAC name is 5-nitro-2-[(1-phenylbenzimidazol-5-yl)amino]pyridine-3-carboxamide.
| Compound Name | 5-nitro-2-[(1-phenylbenzimidazol-5-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133384840 |
| Molecular Formula | C19H14N6O3 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 5-nitro-2-[(1-phenylbenzimidazol-5-yl)amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])cnc1Nc1ccc2c(c1)ncn2-c1ccccc1 |
| InChI | InChI=1S/C19H14N6O3/c20-18(26)15-9-14(25(27)28)10-21-19(15)23-12-6-7-17-16(8-12)22-11-24(17)13-4-2-1-3-5-13/h1-11H,(H2,20,26)(H,21,23) |
| InChIKey | TXAKXKYHICMYJE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|