C14H14F3N3O — CID 133347689
4-methoxy-N-[3-(3,3,3-trifluoropropyl)phenyl]pyrimidin-2-amine (PubChem CID 133347689) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is 4-methoxy-N-[3-(3,3,3-trifluoropropyl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-methoxy-N-[3-(3,3,3-trifluoropropyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 133347689 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-methoxy-N-[3-(3,3,3-trifluoropropyl)phenyl]pyrimidin-2-amine |
| SMILES | COc1ccnc(Nc2cccc(CCC(F)(F)F)c2)n1 |
| InChI | InChI=1S/C14H14F3N3O/c1-21-12-6-8-18-13(20-12)19-11-4-2-3-10(9-11)5-7-14(15,16)17/h2-4,6,8-9H,5,7H2,1H3,(H,18,19,20) |
| InChIKey | ZASHYSRESZMRDJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |