C15H12F4N2O4S — CID 5144454
N-(4-methylphenyl)-2-nitro-4-(1,1,2,2-tetrafluoroethylsulfonyl)aniline (PubChem CID 5144454) has the molecular formula C15H12F4N2O4S and a molecular weight of 392.33 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-nitro-4-(1,1,2,2-tetrafluoroethylsulfonyl)aniline.
| Compound Name | N-(4-methylphenyl)-2-nitro-4-(1,1,2,2-tetrafluoroethylsulfonyl)aniline |
|---|---|
| PubChem CID | 5144454 |
| Molecular Formula | C15H12F4N2O4S |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | N-(4-methylphenyl)-2-nitro-4-(1,1,2,2-tetrafluoroethylsulfonyl)aniline |
| SMILES | Cc1ccc(Nc2ccc(S(=O)(=O)C(F)(F)C(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12F4N2O4S/c1-9-2-4-10(5-3-9)20-12-7-6-11(8-13(12)21(22)23)26(24,25)15(18,19)14(16)17/h2-8,14,20H,1H3 |
| InChIKey | IBDIPERALKKVMK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|