C29H31NO11S — CID 11422051
[(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[2-[2-[(4-methylphenyl)sulfonylamino]phenyl]ethynyl]oxan-2-yl]methyl acetate (PubChem CID 11422051) has the molecular formula C29H31NO11S and a molecular weight of 601.63 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[2-[2-[(4-methylphenyl)sulfonylamino]phenyl]ethynyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[2-[2-[(4-methylphenyl)sulfonylamino]phenyl]ethynyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11422051 |
| Molecular Formula | C29H31NO11S |
| Molecular Weight | 601.63 g/mol |
| Exact Mass | 601.16 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-[2-[2-[(4-methylphenyl)sulfonylamino]phenyl]ethynyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](C#Cc2ccccc2NS(=O)(=O)c2ccc(C)cc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H31NO11S/c1-17-10-13-23(14-11-17)42(35,36)30-24-9-7-6-8-22(24)12-15-25-27(38-19(3)32)29(40-21(5)34)28(39-20(4)33)26(41-25)16-37-18(2)31/h6-11,13-14,25-30H,16H2,1-5H3/t25-,26-,27-,28-,29-/m1/s1 |
| InChIKey | HMCJOVFWDDGLOX-HWVUQVAQSA-N |
| XLogP | 2.27 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.63 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|