C23H31NO11S2 — CID 11050002
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[S-ethyl-N-(4-methylphenyl)sulfonylsulfinimidoyl]oxan-2-yl]methyl acetate (PubChem CID 11050002) has the molecular formula C23H31NO11S2 and a molecular weight of 561.63 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[S-ethyl-N-(4-methylphenyl)sulfonylsulfinimidoyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[S-ethyl-N-(4-methylphenyl)sulfonylsulfinimidoyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11050002 |
| Molecular Formula | C23H31NO11S2 |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[S-ethyl-N-(4-methylphenyl)sulfonylsulfinimidoyl]oxan-2-yl]methyl acetate |
| SMILES | CCS(=NS(=O)(=O)c1ccc(C)cc1)[C@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H31NO11S2/c1-7-36(24-37(29,30)18-10-8-13(2)9-11-18)23-22(34-17(6)28)21(33-16(5)27)20(32-15(4)26)19(35-23)12-31-14(3)25/h8-11,19-23H,7,12H2,1-6H3/t19-,20+,21+,22-,23-,36?/m1/s1 |
| InChIKey | MZAOWTFDXAPSKY-LOVSBYAPSA-N |
| XLogP | 1.59 |
| TPSA | 160.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|