C21H26O10S — CID 101252628
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methylphenyl)sulfinyloxan-2-yl]methyl acetate (PubChem CID 101252628) has the molecular formula C21H26O10S and a molecular weight of 470.50 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methylphenyl)sulfinyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methylphenyl)sulfinyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101252628 |
| Molecular Formula | C21H26O10S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methylphenyl)sulfinyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](S(=O)c2ccc(C)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H26O10S/c1-11-6-8-16(9-7-11)32(26)21-20(30-15(5)25)19(29-14(4)24)18(28-13(3)23)17(31-21)10-27-12(2)22/h6-9,17-21H,10H2,1-5H3/t17-,18+,19+,20-,21+,32?/m1/s1 |
| InChIKey | AANCYYVJNUMXQF-NLEJOYLQSA-N |
| XLogP | 1.19 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|