C15H19NO10 — CID 169437911
[(2S,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-isocyanatooxan-2-yl]methyl acetate (PubChem CID 169437911) has the molecular formula C15H19NO10 and a molecular weight of 373.31 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-isocyanatooxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-isocyanatooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 169437911 |
| Molecular Formula | C15H19NO10 |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-isocyanatooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](OC(C)=O)[C@H](N=C=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H19NO10/c1-7(18)22-5-11-13(23-8(2)19)14(24-9(3)20)12(16-6-17)15(26-11)25-10(4)21/h11-15H,5H2,1-4H3/t11-,12+,13+,14+,15+/m0/s1 |
| InChIKey | RDYCVABPKPHWHC-NJVJYBDUSA-N |
| XLogP | -0.59 |
| TPSA | 143.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|