C7H16NO7P — CID 140635283
[(2R,3S,4R,5R)-5-amino-3,4-dihydroxy-6-methyloxan-2-yl]methyl dihydrogen phosphate (PubChem CID 140635283) has the molecular formula C7H16NO7P and a molecular weight of 257.18 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-amino-3,4-dihydroxy-6-methyloxan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-amino-3,4-dihydroxy-6-methyloxan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 140635283 |
| Molecular Formula | C7H16NO7P |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-amino-3,4-dihydroxy-6-methyloxan-2-yl]methyl dihydrogen phosphate |
| SMILES | CC1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C7H16NO7P/c1-3-5(8)7(10)6(9)4(15-3)2-14-16(11,12)13/h3-7,9-10H,2,8H2,1H3,(H2,11,12,13)/t3?,4-,5+,6-,7-/m1/s1 |
| InChIKey | KMUACIPINUCYAE-BOYHRMMASA-N |
| XLogP | -2.07 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|