C18H35NO7Si — CID 102509192
ethyl 2-[(2S,3R,5S,6R)-3-acetamido-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]acetate (PubChem CID 102509192) has the molecular formula C18H35NO7Si and a molecular weight of 405.56 g/mol. Its IUPAC name is ethyl 2-[(2S,3R,5S,6R)-3-acetamido-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]acetate.
| Compound Name | ethyl 2-[(2S,3R,5S,6R)-3-acetamido-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]acetate |
|---|---|
| PubChem CID | 102509192 |
| Molecular Formula | C18H35NO7Si |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | ethyl 2-[(2S,3R,5S,6R)-3-acetamido-2-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]acetate |
| SMILES | CCOC(=O)CC1[C@@H](NC(C)=O)[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C18H35NO7Si/c1-8-24-14(22)9-12-15(19-11(2)21)17(25-13(10-20)16(12)23)26-27(6,7)18(3,4)5/h12-13,15-17,20,23H,8-10H2,1-7H3,(H,19,21)/t12?,13-,15-,16+,17+/m1/s1 |
| InChIKey | AVAGHAQSSRLEEI-RRHIJNFZSA-N |
| XLogP | 1.16 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|