C7H13KO8S — CID 127050323
potassium [(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methanesulfonate (PubChem CID 127050323) has the molecular formula C7H13KO8S and a molecular weight of 296.34 g/mol. Its IUPAC name is potassium [(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methanesulfonate.
| Compound Name | potassium [(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methanesulfonate |
|---|---|
| PubChem CID | 127050323 |
| Molecular Formula | C7H13KO8S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | potassium [(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methanesulfonate |
| SMILES | CO[C@@H]1O[C@H](CS(=O)(=O)[O-])[C@@H](O)[C@H](O)[C@H]1O.[K+] |
| InChI | InChI=1S/C7H14O8S.K/c1-14-7-6(10)5(9)4(8)3(15-7)2-16(11,12)13;/h3-10H,2H2,1H3,(H,11,12,13);/q;+1/p-1/t3-,4-,5+,6-,7-;/m1./s1 |
| InChIKey | NXKKCAYDNGQPJQ-DEOAAGHXSA-M |
| XLogP | -6.01 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | -6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|