C8H16O8S — CID 44514119
2-[(2R,3S,4S,5S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethanesulfonic acid (PubChem CID 44514119) has the molecular formula C8H16O8S and a molecular weight of 272.28 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethanesulfonic acid.
| Compound Name | 2-[(2R,3S,4S,5S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 44514119 |
| Molecular Formula | C8H16O8S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-[(2R,3S,4S,5S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]ethanesulfonic acid |
| SMILES | COC1O[C@H](CCS(=O)(=O)O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H16O8S/c1-15-8-7(11)6(10)5(9)4(16-8)2-3-17(12,13)14/h4-11H,2-3H2,1H3,(H,12,13,14)/t4-,5-,6+,7+,8?/m1/s1 |
| InChIKey | PHCQZDKMGAYCIF-WZPXOXCRSA-N |
| XLogP | -2.28 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|