C9H16O7 — CID 74085670
3-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)propanoic acid (PubChem CID 74085670) has the molecular formula C9H16O7 and a molecular weight of 236.22 g/mol. Its IUPAC name is 3-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)propanoic acid.
| Compound Name | 3-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 74085670 |
| Molecular Formula | C9H16O7 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 3-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)propanoic acid |
| SMILES | COC1OC(CCC(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C9H16O7/c1-15-9-8(14)7(13)6(12)4(16-9)2-3-5(10)11/h4,6-9,12-14H,2-3H2,1H3,(H,10,11) |
| InChIKey | MUQUNFOHSOSQMG-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |