C9H15NaO7 — CID 23678500
sodium 3-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]propanoate (PubChem CID 23678500) has the molecular formula C9H15NaO7 and a molecular weight of 258.20 g/mol. Its IUPAC name is sodium 3-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]propanoate.
| Compound Name | sodium 3-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]propanoate |
|---|---|
| PubChem CID | 23678500 |
| Molecular Formula | C9H15NaO7 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | sodium 3-[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]propanoate |
| SMILES | CO[C@H]1O[C@H](CCC(=O)[O-])[C@@H](O)[C@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C9H16O7.Na/c1-15-9-8(14)7(13)6(12)4(16-9)2-3-5(10)11;/h4,6-9,12-14H,2-3H2,1H3,(H,10,11);/q;+1/p-1/t4-,6-,7+,8+,9+;/m1./s1 |
| InChIKey | CEDJXDXXSOKGFJ-JYZXNKRMSA-M |
| XLogP | -6.03 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | -6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |