C9H15O10S- — CID 91820441
[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-hydroxy-2-oxopropoxy)oxan-2-yl]methanesulfonate (PubChem CID 91820441) has the molecular formula C9H15O10S- and a molecular weight of 315.28 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-hydroxy-2-oxopropoxy)oxan-2-yl]methanesulfonate.
| Compound Name | [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-hydroxy-2-oxopropoxy)oxan-2-yl]methanesulfonate |
|---|---|
| PubChem CID | 91820441 |
| Molecular Formula | C9H15O10S- |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-hydroxy-2-oxopropoxy)oxan-2-yl]methanesulfonate |
| SMILES | O=C(CO)CO[C@H]1O[C@H](CS(=O)(=O)[O-])[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H16O10S/c10-1-4(11)2-18-9-8(14)7(13)6(12)5(19-9)3-20(15,16)17/h5-10,12-14H,1-3H2,(H,15,16,17)/p-1/t5-,6-,7+,8-,9+/m1/s1 |
| InChIKey | QIDXYXWDZKLVBN-ZEBDFXRSSA-M |
| XLogP | -4.08 |
| TPSA | 173.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|