C12H19NaO10S — CID 23564038
sodium [6-(2-ethynoxy-3-methoxypropoxy)-3,4,5-trihydroxyoxan-2-yl]methanesulfonate (PubChem CID 23564038) has the molecular formula C12H19NaO10S and a molecular weight of 378.33 g/mol. Its IUPAC name is sodium [6-(2-ethynoxy-3-methoxypropoxy)-3,4,5-trihydroxyoxan-2-yl]methanesulfonate.
| Compound Name | sodium [6-(2-ethynoxy-3-methoxypropoxy)-3,4,5-trihydroxyoxan-2-yl]methanesulfonate |
|---|---|
| PubChem CID | 23564038 |
| Molecular Formula | C12H19NaO10S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | sodium [6-(2-ethynoxy-3-methoxypropoxy)-3,4,5-trihydroxyoxan-2-yl]methanesulfonate |
| SMILES | C#COC(COC)COC1OC(CS(=O)(=O)[O-])C(O)C(O)C1O.[Na+] |
| InChI | InChI=1S/C12H20O10S.Na/c1-3-20-7(4-19-2)5-21-12-11(15)10(14)9(13)8(22-12)6-23(16,17)18;/h1,7-15H,4-6H2,2H3,(H,16,17,18);/q;+1/p-1 |
| InChIKey | CRCVTMLOUAGWQW-UHFFFAOYSA-M |
| XLogP | -6.02 |
| TPSA | 154.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | -6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|