C11H22O8S — CID 89269267
[(3S,4R,6S)-3,4,5-trihydroxy-6-(2-methylbutoxy)oxan-2-yl]methanesulfonic acid (PubChem CID 89269267) has the molecular formula C11H22O8S and a molecular weight of 314.36 g/mol. Its IUPAC name is [(3S,4R,6S)-3,4,5-trihydroxy-6-(2-methylbutoxy)oxan-2-yl]methanesulfonic acid.
| Compound Name | [(3S,4R,6S)-3,4,5-trihydroxy-6-(2-methylbutoxy)oxan-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 89269267 |
| Molecular Formula | C11H22O8S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | [(3S,4R,6S)-3,4,5-trihydroxy-6-(2-methylbutoxy)oxan-2-yl]methanesulfonic acid |
| SMILES | CCC(C)CO[C@H]1OC(CS(=O)(=O)O)[C@@H](O)[C@@H](O)C1O |
| InChI | InChI=1S/C11H22O8S/c1-3-6(2)4-18-11-10(14)9(13)8(12)7(19-11)5-20(15,16)17/h6-14H,3-5H2,1-2H3,(H,15,16,17)/t6?,7?,8-,9-,10?,11+/m1/s1 |
| InChIKey | ORJJWJKVPZVGHQ-VQANUAEVSA-N |
| XLogP | -1.26 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|