C12H20O12S — CID 155817580
[(2S,3S,4S,5R,6R)-6-[(2S)-2-acetyloxy-3-formyloxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid (PubChem CID 155817580) has the molecular formula C12H20O12S and a molecular weight of 388.35 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-6-[(2S)-2-acetyloxy-3-formyloxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid.
| Compound Name | [(2S,3S,4S,5R,6R)-6-[(2S)-2-acetyloxy-3-formyloxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 155817580 |
| Molecular Formula | C12H20O12S |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-6-[(2S)-2-acetyloxy-3-formyloxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
| SMILES | CC(=O)O[C@H](COC=O)CO[C@@H]1O[C@H](CS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H20O12S/c1-6(14)23-7(2-21-5-13)3-22-12-11(17)10(16)9(15)8(24-12)4-25(18,19)20/h5,7-12,15-17H,2-4H2,1H3,(H,18,19,20)/t7-,8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | MUGOBSBAMAQKAW-ZZLGJBLRSA-N |
| XLogP | -3.20 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|