C13H22O10 — CID 10382476
[2-acetyloxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] acetate (PubChem CID 10382476) has the molecular formula C13H22O10 and a molecular weight of 338.31 g/mol. Its IUPAC name is [2-acetyloxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] acetate.
| Compound Name | [2-acetyloxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] acetate |
|---|---|
| PubChem CID | 10382476 |
| Molecular Formula | C13H22O10 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [2-acetyloxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] acetate |
| SMILES | CC(=O)OCC(CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)OC(C)=O |
| InChI | InChI=1S/C13H22O10/c1-6(15)20-4-8(22-7(2)16)5-21-13-12(19)11(18)10(17)9(3-14)23-13/h8-14,17-19H,3-5H2,1-2H3/t8?,9-,10+,11+,12-,13-/m1/s1 |
| InChIKey | QTJOSZWLPUKYRL-PTZRQYDVSA-N |
| XLogP | -2.70 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |