C17H30O10 — CID 66677960
[(2S)-2-butanoyloxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] butanoate (PubChem CID 66677960) has the molecular formula C17H30O10 and a molecular weight of 394.42 g/mol. Its IUPAC name is [(2S)-2-butanoyloxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] butanoate.
| Compound Name | [(2S)-2-butanoyloxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] butanoate |
|---|---|
| PubChem CID | 66677960 |
| Molecular Formula | C17H30O10 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [(2S)-2-butanoyloxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] butanoate |
| SMILES | CCCC(=O)OC[C@H](CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)OC(=O)CCC |
| InChI | InChI=1S/C17H30O10/c1-3-5-12(19)24-8-10(26-13(20)6-4-2)9-25-17-16(23)15(22)14(21)11(7-18)27-17/h10-11,14-18,21-23H,3-9H2,1-2H3/t10-,11-,14+,15+,16-,17-/m1/s1 |
| InChIKey | PWERAXPXQPRICV-IPMVXICZSA-N |
| XLogP | -1.14 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |