C17H28O9S-2 — CID 59932073
(3R)-4,5-dimethyl-3-[(5R)-3,4,5-trimethyl-6-(sulfonatooxymethyl)oxan-2-yl]oxyoxane-2-carboxylate (PubChem CID 59932073) has the molecular formula C17H28O9S-2 and a molecular weight of 408.47 g/mol. Its IUPAC name is (3R)-4,5-dimethyl-3-[(5R)-3,4,5-trimethyl-6-(sulfonatooxymethyl)oxan-2-yl]oxyoxane-2-carboxylate.
| Compound Name | (3R)-4,5-dimethyl-3-[(5R)-3,4,5-trimethyl-6-(sulfonatooxymethyl)oxan-2-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 59932073 |
| Molecular Formula | C17H28O9S-2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (3R)-4,5-dimethyl-3-[(5R)-3,4,5-trimethyl-6-(sulfonatooxymethyl)oxan-2-yl]oxyoxane-2-carboxylate |
| SMILES | CC1COC(C(=O)[O-])[C@H](OC2OC(COS(=O)(=O)[O-])[C@H](C)C(C)C2C)C1C |
| InChI | InChI=1S/C17H30O9S/c1-8-6-23-15(16(18)19)14(9(8)2)26-17-12(5)10(3)11(4)13(25-17)7-24-27(20,21)22/h8-15,17H,6-7H2,1-5H3,(H,18,19)(H,20,21,22)/p-2/t8?,9?,10?,11-,12?,13?,14-,15?,17?/m1/s1 |
| InChIKey | ANVCLQRJJXCVCD-HQQCSCMDSA-L |
| XLogP | -0.10 |
| TPSA | 134.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|