C19H34O4 — CID 91573902
(1S,4R,6S)-4-[(2S,3S,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,5,7-trimethyl-3-oxabicyclo[4.1.0]heptan-7-ol (PubChem CID 91573902) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (1S,4R,6S)-4-[(2S,3S,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,5,7-trimethyl-3-oxabicyclo[4.1.0]heptan-7-ol.
| Compound Name | (1S,4R,6S)-4-[(2S,3S,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,5,7-trimethyl-3-oxabicyclo[4.1.0]heptan-7-ol |
|---|---|
| PubChem CID | 91573902 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (1S,4R,6S)-4-[(2S,3S,6R)-2-ethyl-4,5,6-trimethyloxan-3-yl]oxy-2,5,7-trimethyl-3-oxabicyclo[4.1.0]heptan-7-ol |
| SMILES | CC[C@@H]1O[C@H](C)C(C)C(C)[C@@H]1O[C@H]1OC(C)[C@@H]2[C@@H](C1C)C2(C)O |
| InChI | InChI=1S/C19H34O4/c1-8-14-17(10(3)9(2)12(5)21-14)23-18-11(4)15-16(13(6)22-18)19(15,7)20/h9-18,20H,8H2,1-7H3/t9?,10?,11?,12-,13?,14+,15-,16-,17+,18-,19?/m1/s1 |
| InChIKey | XDTYZJODSIHDSL-UMJRNCRJSA-N |
| XLogP | 3.22 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |