C17H25N3O7Si — CID 22524541
[(2S,3S,4S,5R,6S)-3,4-diacetyloxy-5-azido-6-(2-trimethylsilylethynyl)oxan-2-yl]methyl acetate (PubChem CID 22524541) has the molecular formula C17H25N3O7Si and a molecular weight of 411.49 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-3,4-diacetyloxy-5-azido-6-(2-trimethylsilylethynyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-3,4-diacetyloxy-5-azido-6-(2-trimethylsilylethynyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22524541 |
| Molecular Formula | C17H25N3O7Si |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-3,4-diacetyloxy-5-azido-6-(2-trimethylsilylethynyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](C#C[Si](C)(C)C)[C@@H](N=[N+]=[N-])[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H25N3O7Si/c1-10(21)24-9-14-16(25-11(2)22)17(26-12(3)23)15(19-20-18)13(27-14)7-8-28(4,5)6/h13-17H,9H2,1-6H3/t13-,14-,15+,16+,17-/m0/s1 |
| InChIKey | ILRQGIQIIUJHDO-SIRPWMCASA-N |
| XLogP | 1.74 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|