C31H32O5 — CID 11092097
(1R,2R,3R,4S,5S)-5-(furan-2-yl)-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol (PubChem CID 11092097) has the molecular formula C31H32O5 and a molecular weight of 484.59 g/mol. Its IUPAC name is (1R,2R,3R,4S,5S)-5-(furan-2-yl)-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1R,2R,3R,4S,5S)-5-(furan-2-yl)-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 11092097 |
| Molecular Formula | C31H32O5 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (1R,2R,3R,4S,5S)-5-(furan-2-yl)-2,3,4-tris(phenylmethoxy)cyclohexan-1-ol |
| SMILES | O[C@@H]1C[C@H](c2ccco2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C31H32O5/c32-27-19-26(28-17-10-18-33-28)29(34-20-23-11-4-1-5-12-23)31(36-22-25-15-8-3-9-16-25)30(27)35-21-24-13-6-2-7-14-24/h1-18,26-27,29-32H,19-22H2/t26-,27-,29+,30?,31-/m1/s1 |
| InChIKey | GYYBBSIMATURFS-NDOBWZISSA-N |
| XLogP | 5.88 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |