C17H28NO+ — CID 101081564
trimethyl-[[(1R,3S,4S)-3-methyl-4-phenylmethoxycyclopentyl]methyl]azanium (PubChem CID 101081564) has the molecular formula C17H28NO+ and a molecular weight of 262.42 g/mol. Its IUPAC name is trimethyl-[[(1R,3S,4S)-3-methyl-4-phenylmethoxycyclopentyl]methyl]azanium.
| Compound Name | trimethyl-[[(1R,3S,4S)-3-methyl-4-phenylmethoxycyclopentyl]methyl]azanium |
|---|---|
| PubChem CID | 101081564 |
| Molecular Formula | C17H28NO+ |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | trimethyl-[[(1R,3S,4S)-3-methyl-4-phenylmethoxycyclopentyl]methyl]azanium |
| SMILES | C[C@H]1C[C@@H](C[N+](C)(C)C)C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C17H28NO/c1-14-10-16(12-18(2,3)4)11-17(14)19-13-15-8-6-5-7-9-15/h5-9,14,16-17H,10-13H2,1-4H3/q+1/t14-,16+,17-/m0/s1 |
| InChIKey | LXTJVGDMQWTURR-UAGQMJEPSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|