C26H28N2O3 — CID 15851190
(4aS,7S,8S,8aR)-1,4-diphenyl-7-phenylmethoxy-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-8-ol (PubChem CID 15851190) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is (4aS,7S,8S,8aR)-1,4-diphenyl-7-phenylmethoxy-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-8-ol.
| Compound Name | (4aS,7S,8S,8aR)-1,4-diphenyl-7-phenylmethoxy-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-8-ol |
|---|---|
| PubChem CID | 15851190 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (4aS,7S,8S,8aR)-1,4-diphenyl-7-phenylmethoxy-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-8-ol |
| SMILES | O[C@@H]1[C@@H](OCc2ccccc2)OC[C@@H]2[C@H]1N(c1ccccc1)CCN2c1ccccc1 |
| InChI | InChI=1S/C26H28N2O3/c29-25-24-23(19-31-26(25)30-18-20-10-4-1-5-11-20)27(21-12-6-2-7-13-21)16-17-28(24)22-14-8-3-9-15-22/h1-15,23-26,29H,16-19H2/t23-,24-,25+,26+/m1/s1 |
| InChIKey | JAHREXQAOQORME-XPGKHFPBSA-N |
| XLogP | 3.68 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |