C22H26N2O3 — CID 10737641
1-phenyl-4-[(1R,2S,5S,6R)-2-phenylmethoxy-3,7-dioxabicyclo[4.1.0]heptan-5-yl]piperazine (PubChem CID 10737641) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-phenyl-4-[(1R,2S,5S,6R)-2-phenylmethoxy-3,7-dioxabicyclo[4.1.0]heptan-5-yl]piperazine.
| Compound Name | 1-phenyl-4-[(1R,2S,5S,6R)-2-phenylmethoxy-3,7-dioxabicyclo[4.1.0]heptan-5-yl]piperazine |
|---|---|
| PubChem CID | 10737641 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-phenyl-4-[(1R,2S,5S,6R)-2-phenylmethoxy-3,7-dioxabicyclo[4.1.0]heptan-5-yl]piperazine |
| SMILES | c1ccc(CO[C@H]2OC[C@H](N3CCN(c4ccccc4)CC3)[C@H]3O[C@@H]23)cc1 |
| InChI | InChI=1S/C22H26N2O3/c1-3-7-17(8-4-1)15-25-22-21-20(27-21)19(16-26-22)24-13-11-23(12-14-24)18-9-5-2-6-10-18/h1-10,19-22H,11-16H2/t19-,20+,21+,22-/m0/s1 |
| InChIKey | PUYLOZSWFGSWCU-CBPXPLCBSA-N |
| XLogP | 2.52 |
| TPSA | 37.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|