C17H19NO6S — CID 10808819
[(1R,2S,3R,4R,5R)-4-acetamido-2-acetylsulfanyl-6,8-dioxabicyclo[3.2.1]octan-3-yl] benzoate (PubChem CID 10808819) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is [(1R,2S,3R,4R,5R)-4-acetamido-2-acetylsulfanyl-6,8-dioxabicyclo[3.2.1]octan-3-yl] benzoate.
| Compound Name | [(1R,2S,3R,4R,5R)-4-acetamido-2-acetylsulfanyl-6,8-dioxabicyclo[3.2.1]octan-3-yl] benzoate |
|---|---|
| PubChem CID | 10808819 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [(1R,2S,3R,4R,5R)-4-acetamido-2-acetylsulfanyl-6,8-dioxabicyclo[3.2.1]octan-3-yl] benzoate |
| SMILES | CC(=O)N[C@H]1[C@@H]2OC[C@@H](O2)[C@@H](SC(C)=O)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO6S/c1-9(19)18-13-14(24-16(21)11-6-4-3-5-7-11)15(25-10(2)20)12-8-22-17(13)23-12/h3-7,12-15,17H,8H2,1-2H3,(H,18,19)/t12-,13-,14-,15-,17-/m1/s1 |
| InChIKey | FNBZEZMHLWYWNR-DRXUAVOGSA-N |
| XLogP | 1.12 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|