C20H22O4 — CID 100947875
[(1R,2R,6S,7S,10S,12R)-4,4-dimethyl-3,5-dioxatetracyclo[5.5.1.02,6.08,12]tridec-8-en-10-yl] benzoate (PubChem CID 100947875) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is [(1R,2R,6S,7S,10S,12R)-4,4-dimethyl-3,5-dioxatetracyclo[5.5.1.02,6.08,12]tridec-8-en-10-yl] benzoate.
| Compound Name | [(1R,2R,6S,7S,10S,12R)-4,4-dimethyl-3,5-dioxatetracyclo[5.5.1.02,6.08,12]tridec-8-en-10-yl] benzoate |
|---|---|
| PubChem CID | 100947875 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [(1R,2R,6S,7S,10S,12R)-4,4-dimethyl-3,5-dioxatetracyclo[5.5.1.02,6.08,12]tridec-8-en-10-yl] benzoate |
| SMILES | CC1(C)O[C@@H]2[C@@H]3C[C@@H](C4=C[C@@H](OC(=O)c5ccccc5)C[C@@H]43)[C@@H]2O1 |
| InChI | InChI=1S/C20H22O4/c1-20(2)23-17-15-10-16(18(17)24-20)14-9-12(8-13(14)15)22-19(21)11-6-4-3-5-7-11/h3-8,12,14-18H,9-10H2,1-2H3/t12-,14+,15+,16-,17+,18-/m1/s1 |
| InChIKey | DLBOHLFXBCJSKW-FYBLVZLKSA-N |
| XLogP | 3.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|