C20H28O7 — CID 101406718
(4'aS,7'S,7'aR)-7'-[(4-methoxyphenyl)methoxy]-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine] (PubChem CID 101406718) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is (4'aS,7'S,7'aR)-7'-[(4-methoxyphenyl)methoxy]-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine].
| Compound Name | (4'aS,7'S,7'aR)-7'-[(4-methoxyphenyl)methoxy]-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine] |
|---|---|
| PubChem CID | 101406718 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (4'aS,7'S,7'aR)-7'-[(4-methoxyphenyl)methoxy]-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxine] |
| SMILES | COc1ccc(CO[C@H]2[C@@H]3OC(C)(C)OC[C@@H]3OC23COC(C)(C)O3)cc1 |
| InChI | InChI=1S/C20H28O7/c1-18(2)23-11-15-16(26-18)17(20(25-15)12-24-19(3,4)27-20)22-10-13-6-8-14(21-5)9-7-13/h6-9,15-17H,10-12H2,1-5H3/t15-,16+,17-,20?/m0/s1 |
| InChIKey | MEMWVLKOGZYRNW-XKMFVZKXSA-N |
| XLogP | 2.61 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |