C26H34O6 — CID 10928358
1-[(1S,3R,8S,9R,10R,11S,16S)-6,6,12,12-tetramethyl-9-phenylmethoxy-2,5,7,17-tetraoxatetracyclo[8.7.0.03,8.011,16]heptadec-13-en-14-yl]ethanone (PubChem CID 10928358) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is 1-[(1S,3R,8S,9R,10R,11S,16S)-6,6,12,12-tetramethyl-9-phenylmethoxy-2,5,7,17-tetraoxatetracyclo[8.7.0.03,8.011,16]heptadec-13-en-14-yl]ethanone.
| Compound Name | 1-[(1S,3R,8S,9R,10R,11S,16S)-6,6,12,12-tetramethyl-9-phenylmethoxy-2,5,7,17-tetraoxatetracyclo[8.7.0.03,8.011,16]heptadec-13-en-14-yl]ethanone |
|---|---|
| PubChem CID | 10928358 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-[(1S,3R,8S,9R,10R,11S,16S)-6,6,12,12-tetramethyl-9-phenylmethoxy-2,5,7,17-tetraoxatetracyclo[8.7.0.03,8.011,16]heptadec-13-en-14-yl]ethanone |
| SMILES | CC(=O)C1=CC(C)(C)[C@@H]2[C@H]3[C@@H](O[C@H]2C1)O[C@@H]1COC(C)(C)O[C@H]1[C@@H]3OCc1ccccc1 |
| InChI | InChI=1S/C26H34O6/c1-15(27)17-11-18-21(25(2,3)12-17)20-23(28-13-16-9-7-6-8-10-16)22-19(31-24(20)30-18)14-29-26(4,5)32-22/h6-10,12,18-24H,11,13-14H2,1-5H3/t18-,19+,20+,21-,22+,23+,24-/m0/s1 |
| InChIKey | BJPKDAYBBCKNHG-OXBTUOTGSA-N |
| XLogP | 4.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |