C36H40O4 — CID 58133515
(2-benzylphenyl)-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 58133515) has the molecular formula C36H40O4 and a molecular weight of 536.71 g/mol. Its IUPAC name is (2-benzylphenyl)-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | (2-benzylphenyl)-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 58133515 |
| Molecular Formula | C36H40O4 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | (2-benzylphenyl)-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CC[C@H]1O[C@@H](C(O)c2ccccc2Cc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C36H40O4/c1-3-32-26(2)34(38-24-28-17-9-5-10-18-28)36(39-25-29-19-11-6-12-20-29)35(40-32)33(37)31-22-14-13-21-30(31)23-27-15-7-4-8-16-27/h4-22,26,32-37H,3,23-25H2,1-2H3/t26-,32-,33?,34+,35+,36-/m1/s1 |
| InChIKey | SBCXHMBTUQHCOT-DTRRTFELSA-N |
| XLogP | 7.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |