C24H30O6 — CID 71812483
(3aR,5S,6S,7R,7aR)-2-ethoxy-2,5-dimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran (PubChem CID 71812483) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-2-ethoxy-2,5-dimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran.
| Compound Name | (3aR,5S,6S,7R,7aR)-2-ethoxy-2,5-dimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
|---|---|
| PubChem CID | 71812483 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-2-ethoxy-2,5-dimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
| SMILES | CCOC1(C)O[C@H]2O[C@@H](C)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C24H30O6/c1-4-27-24(3)29-22-21(26-16-19-13-9-6-10-14-19)20(17(2)28-23(22)30-24)25-15-18-11-7-5-8-12-18/h5-14,17,20-23H,4,15-16H2,1-3H3/t17-,20-,21+,22+,23+,24?/m0/s1 |
| InChIKey | JAIGKNCEEDGQDH-IFLHPWEWSA-N |
| XLogP | 4.03 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |