C13H20O5 — CID 102019722
(1S,2R,3S,6S,9R)-5-(hydroxymethyl)-12,12-dimethyl-8,11,13-trioxatricyclo[7.4.0.02,6]tridec-4-en-3-ol (PubChem CID 102019722) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (1S,2R,3S,6S,9R)-5-(hydroxymethyl)-12,12-dimethyl-8,11,13-trioxatricyclo[7.4.0.02,6]tridec-4-en-3-ol.
| Compound Name | (1S,2R,3S,6S,9R)-5-(hydroxymethyl)-12,12-dimethyl-8,11,13-trioxatricyclo[7.4.0.02,6]tridec-4-en-3-ol |
|---|---|
| PubChem CID | 102019722 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (1S,2R,3S,6S,9R)-5-(hydroxymethyl)-12,12-dimethyl-8,11,13-trioxatricyclo[7.4.0.02,6]tridec-4-en-3-ol |
| SMILES | CC1(C)OC[C@H]2OC[C@@H]3C(CO)=C[C@H](O)[C@@H]3[C@@H]2O1 |
| InChI | InChI=1S/C13H20O5/c1-13(2)17-6-10-12(18-13)11-8(5-16-10)7(4-14)3-9(11)15/h3,8-12,14-15H,4-6H2,1-2H3/t8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | AWVZEDUTMBBSOJ-IYKVGLELSA-N |
| XLogP | 0.06 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|