C14H14F3N3O — CID 138555125
1-(2-methyloxan-4-yl)-4-(3,4,5-trifluorophenyl)triazole (PubChem CID 138555125) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is 1-(2-methyloxan-4-yl)-4-(3,4,5-trifluorophenyl)triazole.
| Compound Name | 1-(2-methyloxan-4-yl)-4-(3,4,5-trifluorophenyl)triazole |
|---|---|
| PubChem CID | 138555125 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-(2-methyloxan-4-yl)-4-(3,4,5-trifluorophenyl)triazole |
| SMILES | CC1CC(n2cc(-c3cc(F)c(F)c(F)c3)nn2)CCO1 |
| InChI | InChI=1S/C14H14F3N3O/c1-8-4-10(2-3-21-8)20-7-13(18-19-20)9-5-11(15)14(17)12(16)6-9/h5-8,10H,2-4H2,1H3 |
| InChIKey | XHHVBZCJJWWCHI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|