C15H17F2N3O2 — CID 142552631
[4-[4-(3,4-difluoro-5-methylphenyl)triazol-1-yl]oxan-2-yl]methanol (PubChem CID 142552631) has the molecular formula C15H17F2N3O2 and a molecular weight of 309.32 g/mol. Its IUPAC name is [4-[4-(3,4-difluoro-5-methylphenyl)triazol-1-yl]oxan-2-yl]methanol.
| Compound Name | [4-[4-(3,4-difluoro-5-methylphenyl)triazol-1-yl]oxan-2-yl]methanol |
|---|---|
| PubChem CID | 142552631 |
| Molecular Formula | C15H17F2N3O2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | [4-[4-(3,4-difluoro-5-methylphenyl)triazol-1-yl]oxan-2-yl]methanol |
| SMILES | Cc1cc(-c2cn(C3CCOC(CO)C3)nn2)cc(F)c1F |
| InChI | InChI=1S/C15H17F2N3O2/c1-9-4-10(5-13(16)15(9)17)14-7-20(19-18-14)11-2-3-22-12(6-11)8-21/h4-5,7,11-12,21H,2-3,6,8H2,1H3 |
| InChIKey | RIQRRLBZXBOSJG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |