C17H15ClF2N4O3 — CID 175702757
[(2R,4R,6S)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-6-cyanooxan-2-yl]methyl acetate (PubChem CID 175702757) has the molecular formula C17H15ClF2N4O3 and a molecular weight of 396.78 g/mol. Its IUPAC name is [(2R,4R,6S)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-6-cyanooxan-2-yl]methyl acetate.
| Compound Name | [(2R,4R,6S)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-6-cyanooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 175702757 |
| Molecular Formula | C17H15ClF2N4O3 |
| Molecular Weight | 396.78 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [(2R,4R,6S)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-6-cyanooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@H](n2cc(-c3cc(F)c(Cl)c(F)c3)nn2)C[C@@H](C#N)O1 |
| InChI | InChI=1S/C17H15ClF2N4O3/c1-9(25)26-8-13-5-11(4-12(6-21)27-13)24-7-16(22-23-24)10-2-14(19)17(18)15(20)3-10/h2-3,7,11-13H,4-5,8H2,1H3/t11-,12+,13-/m1/s1 |
| InChIKey | ACPNQUVUKJKFQO-FRRDWIJNSA-N |
| XLogP | 3.05 |
| TPSA | 90.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.78 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|