C22H17ClF5N5O4S — CID 162700098
5-[(2R,3R,4S,5R,6R)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]sulfanyl-2-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 162700098) has the molecular formula C22H17ClF5N5O4S and a molecular weight of 577.92 g/mol. Its IUPAC name is 5-[(2R,3R,4S,5R,6R)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]sulfanyl-2-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 5-[(2R,3R,4S,5R,6R)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]sulfanyl-2-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 162700098 |
| Molecular Formula | C22H17ClF5N5O4S |
| Molecular Weight | 577.92 g/mol |
| Exact Mass | 577.06 |
| IUPAC Name | 5-[(2R,3R,4S,5R,6R)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]sulfanyl-2-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(Cl)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1Sc1cnc(C(F)(F)F)c(C#N)c1 |
| InChI | InChI=1S/C22H17ClF5N5O4S/c1-36-19-17(33-7-14(31-32-33)9-3-12(24)16(23)13(25)4-9)18(35)15(8-34)37-21(19)38-11-2-10(5-29)20(30-6-11)22(26,27)28/h2-4,6-7,15,17-19,21,34-35H,8H2,1H3/t15-,17+,18+,19-,21-/m1/s1 |
| InChIKey | MRVGNYDIOGTJBS-YXRUOGEQSA-N |
| XLogP | 3.59 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.92 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|