C20H16F3N5O4S — CID 122468081
5-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carbonitrile (PubChem CID 122468081) has the molecular formula C20H16F3N5O4S and a molecular weight of 479.44 g/mol. Its IUPAC name is 5-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carbonitrile.
| Compound Name | 5-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 122468081 |
| Molecular Formula | C20H16F3N5O4S |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 5-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(S[C@H]2OC(CO)[C@H](O)[C@H](n3cc(-c4cc(F)c(F)c(F)c4)nn3)C2O)cn1 |
| InChI | InChI=1S/C20H16F3N5O4S/c21-12-3-9(4-13(22)16(12)23)14-7-28(27-26-14)17-18(30)15(8-29)32-20(19(17)31)33-11-2-1-10(5-24)25-6-11/h1-4,6-7,15,17-20,29-31H,8H2/t15?,17-,18-,19?,20+/m0/s1 |
| InChIKey | JSWHZEVYGMZUGM-LOVNCYQGSA-N |
| XLogP | 1.40 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|