C21H19F4N3O5S — CID 122468144
(2R,4S,5R)-2-[3-(fluoromethoxy)phenyl]sulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 122468144) has the molecular formula C21H19F4N3O5S and a molecular weight of 501.46 g/mol. Its IUPAC name is (2R,4S,5R)-2-[3-(fluoromethoxy)phenyl]sulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,4S,5R)-2-[3-(fluoromethoxy)phenyl]sulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 122468144 |
| Molecular Formula | C21H19F4N3O5S |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | (2R,4S,5R)-2-[3-(fluoromethoxy)phenyl]sulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | OCC1O[C@H](Sc2cccc(OCF)c2)C(O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C21H19F4N3O5S/c22-9-32-11-2-1-3-12(6-11)34-21-20(31)18(19(30)16(8-29)33-21)28-7-15(26-27-28)10-4-13(23)17(25)14(24)5-10/h1-7,16,18-21,29-31H,8-9H2/t16?,18-,19-,20?,21+/m0/s1 |
| InChIKey | SPFNOOLJHLMUCP-BVPMPBNFSA-N |
| XLogP | 2.44 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|