C26H29F3N4O6S — CID 156636719
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(R)-(4-hydroxyoxan-4-yl)-(3-methyl-2-pyridinyl)methyl]sulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 156636719) has the molecular formula C26H29F3N4O6S and a molecular weight of 582.60 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(R)-(4-hydroxyoxan-4-yl)-(3-methyl-2-pyridinyl)methyl]sulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(R)-(4-hydroxyoxan-4-yl)-(3-methyl-2-pyridinyl)methyl]sulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 156636719 |
| Molecular Formula | C26H29F3N4O6S |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(R)-(4-hydroxyoxan-4-yl)-(3-methyl-2-pyridinyl)methyl]sulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | Cc1cccnc1[C@@H](S[C@@H]1O[C@H](CO)[C@H](O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O)C1(O)CCOCC1 |
| InChI | InChI=1S/C26H29F3N4O6S/c1-13-3-2-6-30-20(13)24(26(37)4-7-38-8-5-26)40-25-23(36)21(22(35)18(12-34)39-25)33-11-17(31-32-33)14-9-15(27)19(29)16(28)10-14/h2-3,6,9-11,18,21-25,34-37H,4-5,7-8,12H2,1H3/t18-,21+,22+,23-,24-,25+/m1/s1 |
| InChIKey | BMWSZQJBMXPYMP-SUVLSFNQSA-N |
| XLogP | 2.06 |
| TPSA | 142.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.60 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|